C28H25F3N4O6 — CID 67515367
3-[[(3R,4S)-4-hydroxy-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-3-yl]amino]cyclohexane-1-carboxylic acid (PubChem CID 67515367) has the molecular formula C28H25F3N4O6 and a molecular weight of 570.52 g/mol. Its IUPAC name is 3-[[(3R,4S)-4-hydroxy-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-3-yl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[[(3R,4S)-4-hydroxy-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-3-yl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67515367 |
| Molecular Formula | C28H25F3N4O6 |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 3-[[(3R,4S)-4-hydroxy-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-3-yl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC(N[C@@H]2COc3cc(-c4noc(-c5onc(-c6ccccc6)c5C(F)(F)F)n4)ccc3[C@@H]2O)C1 |
| InChI | InChI=1S/C28H25F3N4O6/c29-28(30,31)21-22(14-5-2-1-3-6-14)34-40-24(21)26-33-25(35-41-26)15-9-10-18-20(12-15)39-13-19(23(18)36)32-17-8-4-7-16(11-17)27(37)38/h1-3,5-6,9-10,12,16-17,19,23,32,36H,4,7-8,11,13H2,(H,37,38)/t16?,17?,19-,23+/m1/s1 |
| InChIKey | QBSRREIGENYGTO-CCIBYOARSA-N |
| XLogP | 5.10 |
| TPSA | 143.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |