About 2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid
2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid (PubChem CID 67515446) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid |
| PubChem CID | 67515446 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid |
| SMILES | CC1=NN(C)CC1C(=O)O |
| InChI | InChI=1S/C6H10N2O2/c1-4-5(6(9)10)3-8(2)7-4/h5H,3H2,1-2H3,(H,9,10) |
| InChIKey | LVVIFDOTRHUQPL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid?
The IUPAC name of 2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid (CID 67515446) is 2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid.
What is the SMILES notation for 2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid?
The canonical SMILES for 2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid is CC1=NN(C)CC1C(=O)O.
What is the InChIKey of 2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid?
The InChIKey is LVVIFDOTRHUQPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-4-5(6(9)10)3-8(2)7-4/h5H,3H2,1-2H3,(H,9,10).
What are the key properties of 2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid?
2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid has a molecular weight of 142.16 g/mol, XLogP of 0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-3,4-dihydropyrazole-4-carboxylic acid is sourced from PubChem (CID 67515446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).