About [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate
[2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate (PubChem CID 67515459) has the molecular formula C15H26O5
and a molecular weight of 286.37 g/mol. Its IUPAC name is [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate.
Molecular Properties
| Compound Name | [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate |
| PubChem CID | 67515459 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate |
| SMILES | COCC(=O)OCC(=O)OC(C)C1CCCC(C)(C)C1 |
| InChI | InChI=1S/C15H26O5/c1-11(12-6-5-7-15(2,3)8-12)20-14(17)10-19-13(16)9-18-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | GQSODOYTNTXNHP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate?
The IUPAC name of [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate (CID 67515459) is [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate.
What is the SMILES notation for [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate?
The canonical SMILES for [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate is COCC(=O)OCC(=O)OC(C)C1CCCC(C)(C)C1.
What is the InChIKey of [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate?
The InChIKey is GQSODOYTNTXNHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O5/c1-11(12-6-5-7-15(2,3)8-12)20-14(17)10-19-13(16)9-18-4/h11-12H,5-10H2,1-4H3.
What are the key properties of [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate?
[2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate has a molecular weight of 286.37 g/mol, XLogP of 2.32, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] 2-methoxyacetate is sourced from PubChem (CID 67515459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).