C6Br2Cl2N2S — CID 67515482
4,7-dibromo-5,6-dichloro-2,1,3-benzothiadiazole (PubChem CID 67515482) has the molecular formula C6Br2Cl2N2S and a molecular weight of 362.86 g/mol. Its IUPAC name is 4,7-dibromo-5,6-dichloro-2,1,3-benzothiadiazole.
| Compound Name | 4,7-dibromo-5,6-dichloro-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 67515482 |
| Molecular Formula | C6Br2Cl2N2S |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 359.75 |
| IUPAC Name | 4,7-dibromo-5,6-dichloro-2,1,3-benzothiadiazole |
| SMILES | Clc1c(Cl)c(Br)c2nsnc2c1Br |
| InChI | InChI=1S/C6Br2Cl2N2S/c7-1-3(9)4(10)2(8)6-5(1)11-13-12-6 |
| InChIKey | HIAJJWRLCFFJRQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|