C21H28O2 — CID 67516147
(1S,13R)-1,13-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5-trien-11-one (PubChem CID 67516147) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is (1S,13R)-1,13-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5-trien-11-one.
| Compound Name | (1S,13R)-1,13-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5-trien-11-one |
|---|---|
| PubChem CID | 67516147 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (1S,13R)-1,13-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5-trien-11-one |
| SMILES | CC(C)c1ccc2c(c1)CC1OC(=O)C[C@@]3(C)CCC[C@@]2(C)C13 |
| InChI | InChI=1S/C21H28O2/c1-13(2)14-6-7-16-15(10-14)11-17-19-20(3,12-18(22)23-17)8-5-9-21(16,19)4/h6-7,10,13,17,19H,5,8-9,11-12H2,1-4H3/t17?,19?,20-,21-/m1/s1 |
| InChIKey | JNEGMXQXURCUAH-CGNZLSCGSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |