C16H36N4 — CID 67516267
1,2,2,3,3,4-hexamethyl-1,4,8,11-tetrazacyclotetradecane (PubChem CID 67516267) has the molecular formula C16H36N4 and a molecular weight of 284.49 g/mol. Its IUPAC name is 1,2,2,3,3,4-hexamethyl-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 1,2,2,3,3,4-hexamethyl-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 67516267 |
| Molecular Formula | C16H36N4 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.29 |
| IUPAC Name | 1,2,2,3,3,4-hexamethyl-1,4,8,11-tetrazacyclotetradecane |
| SMILES | CN1CCCNCCNCCCN(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H36N4/c1-15(2)16(3,4)20(6)14-8-10-18-12-11-17-9-7-13-19(15)5/h17-18H,7-14H2,1-6H3 |
| InChIKey | HJMPLWJZJSBDDQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |