C10H9Cl2NO2 — CID 67516388
1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid (PubChem CID 67516388) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid.
| Compound Name | 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 67516388 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid |
| SMILES | O=C(O)C1=C2C=CCC=C2C(Cl)NC1Cl |
| InChI | InChI=1S/C10H9Cl2NO2/c11-8-6-4-2-1-3-5(6)7(10(14)15)9(12)13-8/h1,3-4,8-9,13H,2H2,(H,14,15) |
| InChIKey | FSSLSBZZWLOSOP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|