1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid

C10H9Cl2NO2 — CID 67516388

IUPAC1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid
SMILESO=C(O)C1=C2C=CCC=C2C(Cl)NC1Cl
InChIInChI=1S/C10H9Cl2NO2/c11-8-6-4-2-1-3-5(6)7(10(14)15)9(12)13-8/h1,3-4,8-9,13H,2H2,(H,14,15)
InChIKeyFSSLSBZZWLOSOP-UHFFFAOYSA-N
MW246.09 g/mol
LogP1.99
Rot. Bonds1

About 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid

1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid (PubChem CID 67516388) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid.

Molecular Properties

Compound Name1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid
PubChem CID67516388
Molecular FormulaC10H9Cl2NO2
Molecular Weight246.09 g/mol
Exact Mass245.00
IUPAC Name1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid
SMILESO=C(O)C1=C2C=CCC=C2C(Cl)NC1Cl
InChIInChI=1S/C10H9Cl2NO2/c11-8-6-4-2-1-3-5(6)7(10(14)15)9(12)13-8/h1,3-4,8-9,13H,2H2,(H,14,15)
InChIKeyFSSLSBZZWLOSOP-UHFFFAOYSA-N
XLogP1.99
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.09
LogP ≤ 51.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid?
The IUPAC name of 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid (CID 67516388) is 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid.
What is the SMILES notation for 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid?
The canonical SMILES for 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid is O=C(O)C1=C2C=CCC=C2C(Cl)NC1Cl.
What is the InChIKey of 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid?
The InChIKey is FSSLSBZZWLOSOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2NO2/c11-8-6-4-2-1-3-5(6)7(10(14)15)9(12)13-8/h1,3-4,8-9,13H,2H2,(H,14,15).
What are the key properties of 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid?
1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid has a molecular weight of 246.09 g/mol, XLogP of 1.99, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid is sourced from PubChem (CID 67516388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).