C29H45NO4 — CID 67516433
6-[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]hexan-2-amine;(E)-but-2-enedioic acid (PubChem CID 67516433) has the molecular formula C29H45NO4 and a molecular weight of 471.68 g/mol. Its IUPAC name is 6-[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]hexan-2-amine;(E)-but-2-enedioic acid.
| Compound Name | 6-[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]hexan-2-amine;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 67516433 |
| Molecular Formula | C29H45NO4 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | 6-[(1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]hexan-2-amine;(E)-but-2-enedioic acid |
| SMILES | CC(N)CCCC[C@]1(C)CCC[C@]2(C)c3ccc(C(C)C)cc3CC[C@@H]12.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C25H41N.C4H4O4/c1-18(2)20-10-12-22-21(17-20)11-13-23-24(4,14-7-6-9-19(3)26)15-8-16-25(22,23)5;5-3(6)1-2-4(7)8/h10,12,17-19,23H,6-9,11,13-16,26H2,1-5H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t19?,23-,24+,25+;/m0./s1 |
| InChIKey | PFGWLPVEIIAQMX-GRTDZYQNSA-N |
| XLogP | 6.44 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|