About 1-ethenyl-3,3-diethylpiperidin-2-one
1-ethenyl-3,3-diethylpiperidin-2-one (PubChem CID 67516900) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-ethenyl-3,3-diethylpiperidin-2-one.
Molecular Properties
| Compound Name | 1-ethenyl-3,3-diethylpiperidin-2-one |
| PubChem CID | 67516900 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-ethenyl-3,3-diethylpiperidin-2-one |
| SMILES | C=CN1CCCC(CC)(CC)C1=O |
| InChI | InChI=1S/C11H19NO/c1-4-11(5-2)8-7-9-12(6-3)10(11)13/h6H,3-5,7-9H2,1-2H3 |
| InChIKey | YSLRFCIUKLSYPJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-3,3-diethylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3,3-diethylpiperidin-2-one?
The IUPAC name of 1-ethenyl-3,3-diethylpiperidin-2-one (CID 67516900) is 1-ethenyl-3,3-diethylpiperidin-2-one.
What is the SMILES notation for 1-ethenyl-3,3-diethylpiperidin-2-one?
The canonical SMILES for 1-ethenyl-3,3-diethylpiperidin-2-one is C=CN1CCCC(CC)(CC)C1=O.
What is the InChIKey of 1-ethenyl-3,3-diethylpiperidin-2-one?
The InChIKey is YSLRFCIUKLSYPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-4-11(5-2)8-7-9-12(6-3)10(11)13/h6H,3-5,7-9H2,1-2H3.
What are the key properties of 1-ethenyl-3,3-diethylpiperidin-2-one?
1-ethenyl-3,3-diethylpiperidin-2-one has a molecular weight of 181.28 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3,3-diethylpiperidin-2-one is sourced from PubChem (CID 67516900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).