C23H20FN5O3 — CID 67516962
1-N'-[[4-[5-fluoro-2-(3-methyl-1,2,4-oxadiazol-5-yl)indol-1-yl]phenyl]methyl]cyclopropane-1,1-dicarboxamide (PubChem CID 67516962) has the molecular formula C23H20FN5O3 and a molecular weight of 433.44 g/mol. Its IUPAC name is 1-N'-[[4-[5-fluoro-2-(3-methyl-1,2,4-oxadiazol-5-yl)indol-1-yl]phenyl]methyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[[4-[5-fluoro-2-(3-methyl-1,2,4-oxadiazol-5-yl)indol-1-yl]phenyl]methyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 67516962 |
| Molecular Formula | C23H20FN5O3 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-N'-[[4-[5-fluoro-2-(3-methyl-1,2,4-oxadiazol-5-yl)indol-1-yl]phenyl]methyl]cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1noc(-c2cc3cc(F)ccc3n2-c2ccc(CNC(=O)C3(C(N)=O)CC3)cc2)n1 |
| InChI | InChI=1S/C23H20FN5O3/c1-13-27-20(32-28-13)19-11-15-10-16(24)4-7-18(15)29(19)17-5-2-14(3-6-17)12-26-22(31)23(8-9-23)21(25)30/h2-7,10-11H,8-9,12H2,1H3,(H2,25,30)(H,26,31) |
| InChIKey | AIFWWQAEEBGIAA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 116.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|