About 3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine
3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine (PubChem CID 67517089) has the molecular formula C33H63NO2
and a molecular weight of 505.87 g/mol. Its IUPAC name is 3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine.
Molecular Properties
| Compound Name | 3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine |
| PubChem CID | 67517089 |
| Molecular Formula | C33H63NO2 |
| Molecular Weight | 505.87 g/mol |
| Exact Mass | 505.49 |
| IUPAC Name | 3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine |
| SMILES | CCCCCC=CCC=CCCCCCCCCOC1CN(C)CC1OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C33H63NO2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26-35-32-28-34(5)29-33(32)36-27-25-31(4)24-22-23-30(2)3/h10-11,13-14,30-33H,6-9,12,15-29H2,1-5H3 |
| InChIKey | CHKDOIWYNITJJV-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.87 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine?
The IUPAC name of 3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine (CID 67517089) is 3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine.
What is the SMILES notation for 3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine?
The canonical SMILES for 3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine is CCCCCC=CCC=CCCCCCCCCOC1CN(C)CC1OCCC(C)CCCC(C)C.
What is the InChIKey of 3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine?
The InChIKey is CHKDOIWYNITJJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H63NO2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26-35-32-28-34(5)29-33(32)36-27-25-31(4)24-22-23-30(2)3/h10-11,13-14,30-33H,6-9,12,15-29H2,1-5H3.
What are the key properties of 3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine?
3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine has a molecular weight of 505.87 g/mol, XLogP of 9.37, 24 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,7-dimethyloctoxy)-1-methyl-4-octadeca-9,12-dienoxypyrrolidine is sourced from PubChem (CID 67517089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).