C26H31BN4O4S — CID 67517201
1-(benzenesulfonyl)-5-(1-tert-butylpyrazol-4-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (PubChem CID 67517201) has the molecular formula C26H31BN4O4S and a molecular weight of 506.44 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-(1-tert-butylpyrazol-4-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 1-(benzenesulfonyl)-5-(1-tert-butylpyrazol-4-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 67517201 |
| Molecular Formula | C26H31BN4O4S |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 1-(benzenesulfonyl)-5-(1-tert-butylpyrazol-4-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| SMILES | CC(C)(C)n1cc(-c2cnc3c(c2)c(B2OC(C)(C)C(C)(C)O2)cn3S(=O)(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C26H31BN4O4S/c1-24(2,3)31-16-19(15-29-31)18-13-21-22(27-34-25(4,5)26(6,7)35-27)17-30(23(21)28-14-18)36(32,33)20-11-9-8-10-12-20/h8-17H,1-7H3 |
| InChIKey | KODCGXPVUVWWPK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|