C26H45N5O4Si2 — CID 67517432
3-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 67517432) has the molecular formula C26H45N5O4Si2 and a molecular weight of 547.85 g/mol. Its IUPAC name is 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 67517432 |
| Molecular Formula | C26H45N5O4Si2 |
| Molecular Weight | 547.85 g/mol |
| Exact Mass | 547.30 |
| IUPAC Name | 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2CC3CCC(C2)N3C(=O)O)nc2ccnn12 |
| InChI | InChI=1S/C26H45N5O4Si2/c1-36(2,3)13-11-34-18-29(19-35-12-14-37(4,5)6)25-17-23(28-24-9-10-27-31(24)25)20-15-21-7-8-22(16-20)30(21)26(32)33/h9-10,17,20-22H,7-8,11-16,18-19H2,1-6H3,(H,32,33) |
| InChIKey | ONGZJXRDDDCGDL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.85 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|