About 3-pyrazol-1-ylazepane
3-pyrazol-1-ylazepane (PubChem CID 67517483) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-pyrazol-1-ylazepane.
Molecular Properties
| Compound Name | 3-pyrazol-1-ylazepane |
| PubChem CID | 67517483 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 3-pyrazol-1-ylazepane |
| SMILES | c1cnn(C2CCCCNC2)c1 |
| InChI | InChI=1S/C9H15N3/c1-2-5-10-8-9(4-1)12-7-3-6-11-12/h3,6-7,9-10H,1-2,4-5,8H2 |
| InChIKey | AQAVRTLPNHEJGF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-pyrazol-1-ylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrazol-1-ylazepane?
The IUPAC name of 3-pyrazol-1-ylazepane (CID 67517483) is 3-pyrazol-1-ylazepane.
What is the SMILES notation for 3-pyrazol-1-ylazepane?
The canonical SMILES for 3-pyrazol-1-ylazepane is c1cnn(C2CCCCNC2)c1.
What is the InChIKey of 3-pyrazol-1-ylazepane?
The InChIKey is AQAVRTLPNHEJGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-2-5-10-8-9(4-1)12-7-3-6-11-12/h3,6-7,9-10H,1-2,4-5,8H2.
What are the key properties of 3-pyrazol-1-ylazepane?
3-pyrazol-1-ylazepane has a molecular weight of 165.24 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrazol-1-ylazepane is sourced from PubChem (CID 67517483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).