C24H20N2O5 — CID 6751757
(5R)-5-(3,4-dimethoxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-pyridin-2-ylpyrrolidine-2,3-dione (PubChem CID 6751757) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is (5R)-5-(3,4-dimethoxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-pyridin-2-ylpyrrolidine-2,3-dione.
| Compound Name | (5R)-5-(3,4-dimethoxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-pyridin-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6751757 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (5R)-5-(3,4-dimethoxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-pyridin-2-ylpyrrolidine-2,3-dione |
| SMILES | COc1ccc([C@@H]2C(=C(O)c3ccccc3)C(=O)C(=O)N2c2ccccn2)cc1OC |
| InChI | InChI=1S/C24H20N2O5/c1-30-17-12-11-16(14-18(17)31-2)21-20(22(27)15-8-4-3-5-9-15)23(28)24(29)26(21)19-10-6-7-13-25-19/h3-14,21,27H,1-2H3/t21-/m1/s1 |
| InChIKey | ZDVZNGMFKKFHRR-OAQYLSRUSA-N |
| XLogP | 3.73 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|