C13H16N2O — CID 67517694
1,6-diazatricyclo[9.4.0.03,8]pentadeca-4,6,13-trien-2-one (PubChem CID 67517694) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1,6-diazatricyclo[9.4.0.03,8]pentadeca-4,6,13-trien-2-one.
| Compound Name | 1,6-diazatricyclo[9.4.0.03,8]pentadeca-4,6,13-trien-2-one |
|---|---|
| PubChem CID | 67517694 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1,6-diazatricyclo[9.4.0.03,8]pentadeca-4,6,13-trien-2-one |
| SMILES | O=C1C2C=CN=CC2CCC2CC=CCN12 |
| InChI | InChI=1S/C13H16N2O/c16-13-12-6-7-14-9-10(12)4-5-11-3-1-2-8-15(11)13/h1-2,6-7,9-12H,3-5,8H2 |
| InChIKey | VBFIMIMSEKBEDV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|