C21H19FN2OS2 — CID 67517712
3-fluoro-9-(4-thiophen-3-yl-1,3-thiazol-2-yl)-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-b][2]benzazepin-12-one (PubChem CID 67517712) has the molecular formula C21H19FN2OS2 and a molecular weight of 398.53 g/mol. Its IUPAC name is 3-fluoro-9-(4-thiophen-3-yl-1,3-thiazol-2-yl)-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-b][2]benzazepin-12-one.
| Compound Name | 3-fluoro-9-(4-thiophen-3-yl-1,3-thiazol-2-yl)-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-b][2]benzazepin-12-one |
|---|---|
| PubChem CID | 67517712 |
| Molecular Formula | C21H19FN2OS2 |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 3-fluoro-9-(4-thiophen-3-yl-1,3-thiazol-2-yl)-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-b][2]benzazepin-12-one |
| SMILES | O=C1c2ccc(F)cc2CCC2CCC(c3nc(-c4ccsc4)cs3)CN12 |
| InChI | InChI=1S/C21H19FN2OS2/c22-16-3-6-18-13(9-16)1-4-17-5-2-14(10-24(17)21(18)25)20-23-19(12-27-20)15-7-8-26-11-15/h3,6-9,11-12,14,17H,1-2,4-5,10H2 |
| InChIKey | JFBFPFOXNRDMMY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |