C27H33F2N3O4 — CID 67517814
benzyl 1-(2-amino-3,3-dimethylbutanoyl)-6-[(3,4-difluorophenoxy)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 67517814) has the molecular formula C27H33F2N3O4 and a molecular weight of 501.57 g/mol. Its IUPAC name is benzyl 1-(2-amino-3,3-dimethylbutanoyl)-6-[(3,4-difluorophenoxy)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | benzyl 1-(2-amino-3,3-dimethylbutanoyl)-6-[(3,4-difluorophenoxy)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 67517814 |
| Molecular Formula | C27H33F2N3O4 |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | benzyl 1-(2-amino-3,3-dimethylbutanoyl)-6-[(3,4-difluorophenoxy)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)C(N)C(=O)N1CCC2C1C(COc1ccc(F)c(F)c1)CN2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H33F2N3O4/c1-27(2,3)24(30)25(33)31-12-11-22-23(31)18(16-35-19-9-10-20(28)21(29)13-19)14-32(22)26(34)36-15-17-7-5-4-6-8-17/h4-10,13,18,22-24H,11-12,14-16,30H2,1-3H3 |
| InChIKey | ULLBAGLYPSNMIJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |