About 4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one
4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one (PubChem CID 67517926) has the molecular formula C18H14BrN3O
and a molecular weight of 368.23 g/mol. Its IUPAC name is 4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one |
| PubChem CID | 67517926 |
| Molecular Formula | C18H14BrN3O |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one |
| SMILES | O=C1c2cccc(Br)c2CN1CCc1ccc2ncccc2n1 |
| InChI | InChI=1S/C18H14BrN3O/c19-15-4-1-3-13-14(15)11-22(18(13)23)10-8-12-6-7-16-17(21-12)5-2-9-20-16/h1-7,9H,8,10-11H2 |
| InChIKey | LNGJLWPNEDERNR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one?
The IUPAC name of 4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one (CID 67517926) is 4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one.
What is the SMILES notation for 4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one?
The canonical SMILES for 4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one is O=C1c2cccc(Br)c2CN1CCc1ccc2ncccc2n1.
What is the InChIKey of 4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one?
The InChIKey is LNGJLWPNEDERNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrN3O/c19-15-4-1-3-13-14(15)11-22(18(13)23)10-8-12-6-7-16-17(21-12)5-2-9-20-16/h1-7,9H,8,10-11H2.
What are the key properties of 4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one?
4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one has a molecular weight of 368.23 g/mol, XLogP of 3.59, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-[2-(1,5-naphthyridin-2-yl)ethyl]-3H-isoindol-1-one is sourced from PubChem (CID 67517926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).