C18H17NO5S — CID 67518071
(5,6-dioxospiro[3H-benzo[h][1,4]benzoxathiine-2,4'-cyclohexane]-1'-yl)carbamic acid (PubChem CID 67518071) has the molecular formula C18H17NO5S and a molecular weight of 359.40 g/mol. Its IUPAC name is (5,6-dioxospiro[3H-benzo[h][1,4]benzoxathiine-2,4'-cyclohexane]-1'-yl)carbamic acid.
| Compound Name | (5,6-dioxospiro[3H-benzo[h][1,4]benzoxathiine-2,4'-cyclohexane]-1'-yl)carbamic acid |
|---|---|
| PubChem CID | 67518071 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (5,6-dioxospiro[3H-benzo[h][1,4]benzoxathiine-2,4'-cyclohexane]-1'-yl)carbamic acid |
| SMILES | O=C(O)NC1CCC2(CC1)CSC1=C(O2)c2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C18H17NO5S/c20-13-11-3-1-2-4-12(11)15-16(14(13)21)25-9-18(24-15)7-5-10(6-8-18)19-17(22)23/h1-4,10,19H,5-9H2,(H,22,23) |
| InChIKey | ZPRIZFQDMMCFAM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|