C19H41N2O2+ — CID 67518308
triethyl-[4-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxybutyl]azanium (PubChem CID 67518308) has the molecular formula C19H41N2O2+ and a molecular weight of 329.55 g/mol. Its IUPAC name is triethyl-[4-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxybutyl]azanium.
| Compound Name | triethyl-[4-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxybutyl]azanium |
|---|---|
| PubChem CID | 67518308 |
| Molecular Formula | C19H41N2O2+ |
| Molecular Weight | 329.55 g/mol |
| Exact Mass | 329.32 |
| IUPAC Name | triethyl-[4-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxybutyl]azanium |
| SMILES | CC[N+](CC)(CC)CCCCOC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C19H41N2O2/c1-8-21(9-2,10-3)13-11-12-14-23-17-15-18(4,5)20(22)19(6,7)16-17/h17,22H,8-16H2,1-7H3/q+1 |
| InChIKey | LZTDLMHQLZPMFQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|