About 1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone
1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone (PubChem CID 67518479) has the molecular formula C19H25NO2
and a molecular weight of 299.41 g/mol. Its IUPAC name is 1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone |
| PubChem CID | 67518479 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone |
| SMILES | CC(=O)C1CC(Oc2cccc3c2C=CCC3)CN1C(C)C |
| InChI | InChI=1S/C19H25NO2/c1-13(2)20-12-16(11-18(20)14(3)21)22-19-10-6-8-15-7-4-5-9-17(15)19/h5-6,8-10,13,16,18H,4,7,11-12H2,1-3H3 |
| InChIKey | SELVXMHHIWVWHC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone?
The IUPAC name of 1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone (CID 67518479) is 1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone.
What is the SMILES notation for 1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone?
The canonical SMILES for 1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone is CC(=O)C1CC(Oc2cccc3c2C=CCC3)CN1C(C)C.
What is the InChIKey of 1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone?
The InChIKey is SELVXMHHIWVWHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO2/c1-13(2)20-12-16(11-18(20)14(3)21)22-19-10-6-8-15-7-4-5-9-17(15)19/h5-6,8-10,13,16,18H,4,7,11-12H2,1-3H3.
What are the key properties of 1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone?
1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone has a molecular weight of 299.41 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(5,6-dihydronaphthalen-1-yloxy)-1-propan-2-ylpyrrolidin-2-yl]ethanone is sourced from PubChem (CID 67518479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).