C10H19N5O3 — CID 67518530
1-[methoxymethyl-[4-(methoxymethylamino)-6-methyl-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 67518530) has the molecular formula C10H19N5O3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-[methoxymethyl-[4-(methoxymethylamino)-6-methyl-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 1-[methoxymethyl-[4-(methoxymethylamino)-6-methyl-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 67518530 |
| Molecular Formula | C10H19N5O3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 1-[methoxymethyl-[4-(methoxymethylamino)-6-methyl-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | COCNc1nc(C)nc(N(COC)C(C)O)n1 |
| InChI | InChI=1S/C10H19N5O3/c1-7-12-9(11-5-17-3)14-10(13-7)15(6-18-4)8(2)16/h8,16H,5-6H2,1-4H3,(H,11,12,13,14) |
| InChIKey | NVSAKLGZHNBCNY-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|