C9H15N3 — CID 67518556
N-methyl-1,2,3,4,4a,8a-hexahydro-1,8-naphthyridin-4-amine (PubChem CID 67518556) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is N-methyl-1,2,3,4,4a,8a-hexahydro-1,8-naphthyridin-4-amine.
| Compound Name | N-methyl-1,2,3,4,4a,8a-hexahydro-1,8-naphthyridin-4-amine |
|---|---|
| PubChem CID | 67518556 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N-methyl-1,2,3,4,4a,8a-hexahydro-1,8-naphthyridin-4-amine |
| SMILES | CNC1CCNC2N=CC=CC12 |
| InChI | InChI=1S/C9H15N3/c1-10-8-4-6-12-9-7(8)3-2-5-11-9/h2-3,5,7-10,12H,4,6H2,1H3 |
| InChIKey | ONFPUPCWYMISBL-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |