C15H20O11 — CID 67518558
methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate (PubChem CID 67518558) has the molecular formula C15H20O11 and a molecular weight of 376.31 g/mol. Its IUPAC name is methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate.
| Compound Name | methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 67518558 |
| Molecular Formula | C15H20O11 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate |
| SMILES | COC(=O)C1O[C@@H](OC(C)=O)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H20O11/c1-6(16)22-10-11(23-7(2)17)13(24-8(3)18)15(25-9(4)19)26-12(10)14(20)21-5/h10-13,15H,1-5H3/t10-,11?,12?,13?,15+/m0/s1 |
| InChIKey | DPOQCELSZBSZGX-CEJAEVFISA-N |
| XLogP | -0.76 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|