methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate

C15H20O11 — CID 67518558

IUPACmethyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate
SMILESCOC(=O)C1O[C@@H](OC(C)=O)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O
InChIInChI=1S/C15H20O11/c1-6(16)22-10-11(23-7(2)17)13(24-8(3)18)15(25-9(4)19)26-12(10)14(20)21-5/h10-13,15H,1-5H3/t10-,11?,12?,13?,15+/m0/s1
InChIKeyDPOQCELSZBSZGX-CEJAEVFISA-N
MW376.31 g/mol
LogP-0.76
Rot. Bonds5

About methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate

methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate (PubChem CID 67518558) has the molecular formula C15H20O11 and a molecular weight of 376.31 g/mol. Its IUPAC name is methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate.

Molecular Properties

Compound Namemethyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate
PubChem CID67518558
Molecular FormulaC15H20O11
Molecular Weight376.31 g/mol
Exact Mass376.10
IUPAC Namemethyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate
SMILESCOC(=O)C1O[C@@H](OC(C)=O)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O
InChIInChI=1S/C15H20O11/c1-6(16)22-10-11(23-7(2)17)13(24-8(3)18)15(25-9(4)19)26-12(10)14(20)21-5/h10-13,15H,1-5H3/t10-,11?,12?,13?,15+/m0/s1
InChIKeyDPOQCELSZBSZGX-CEJAEVFISA-N
XLogP-0.76
TPSA140.73 Ų
H-Bond Donors
H-Bond Acceptors11
Rotatable Bonds5
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500376.31
LogP ≤ 5-0.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 1011

Computed Properties (RDKit)

Structural Alerts{'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}

Analyze methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate?
The IUPAC name of methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate (CID 67518558) is methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate.
What is the SMILES notation for methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate?
The canonical SMILES for methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate is COC(=O)C1O[C@@H](OC(C)=O)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O.
What is the InChIKey of methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate?
The InChIKey is DPOQCELSZBSZGX-CEJAEVFISA-N. The full InChI is InChI=1S/C15H20O11/c1-6(16)22-10-11(23-7(2)17)13(24-8(3)18)15(25-9(4)19)26-12(10)14(20)21-5/h10-13,15H,1-5H3/t10-,11?,12?,13?,15+/m0/s1.
What are the key properties of methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate?
methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate has a molecular weight of 376.31 g/mol, XLogP of -0.76, 5 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate is sourced from PubChem (CID 67518558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).