C34H56O5 — CID 67518700
6-[2-hydroxy-3-[2-[2-hydroxy-3-(5-methoxy-5-methylhexyl)cyclohexyl]phenyl]cyclohexyl]-2,2-dimethylhexanoic acid (PubChem CID 67518700) has the molecular formula C34H56O5 and a molecular weight of 544.82 g/mol. Its IUPAC name is 6-[2-hydroxy-3-[2-[2-hydroxy-3-(5-methoxy-5-methylhexyl)cyclohexyl]phenyl]cyclohexyl]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[2-hydroxy-3-[2-[2-hydroxy-3-(5-methoxy-5-methylhexyl)cyclohexyl]phenyl]cyclohexyl]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 67518700 |
| Molecular Formula | C34H56O5 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.41 |
| IUPAC Name | 6-[2-hydroxy-3-[2-[2-hydroxy-3-(5-methoxy-5-methylhexyl)cyclohexyl]phenyl]cyclohexyl]-2,2-dimethylhexanoic acid |
| SMILES | COC(C)(C)CCCCC1CCCC(c2ccccc2C2CCCC(CCCCC(C)(C)C(=O)O)C2O)C1O |
| InChI | InChI=1S/C34H56O5/c1-33(2,32(37)38)22-10-8-14-24-16-12-20-28(30(24)35)26-18-6-7-19-27(26)29-21-13-17-25(31(29)36)15-9-11-23-34(3,4)39-5/h6-7,18-19,24-25,28-31,35-36H,8-17,20-23H2,1-5H3,(H,37,38) |
| InChIKey | JHGPIUSMSQYILF-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|