C10H17NO — CID 67518732
[(1S,3aR,7R,7aS)-7-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-1-yl]methanol (PubChem CID 67518732) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is [(1S,3aR,7R,7aS)-7-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-1-yl]methanol.
| Compound Name | [(1S,3aR,7R,7aS)-7-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-1-yl]methanol |
|---|---|
| PubChem CID | 67518732 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | [(1S,3aR,7R,7aS)-7-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-1-yl]methanol |
| SMILES | C[C@@H]1C=CC[C@H]2CN[C@H](CO)[C@H]21 |
| InChI | InChI=1S/C10H17NO/c1-7-3-2-4-8-5-11-9(6-12)10(7)8/h2-3,7-12H,4-6H2,1H3/t7-,8+,9-,10+/m1/s1 |
| InChIKey | FLZAOJCNAMOKLJ-RGOKHQFPSA-N |
| XLogP | 0.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|