C31H34FN5O6 — CID 67519085
[2-fluoro-4-[[1-(2-hydroxy-2-methylpropyl)-5-methyl-3-oxo-2-phenylpyrazole-4-carbonyl]amino]phenyl] 4,5-dimethoxy-2-(methylamino)benzenecarboximidate (PubChem CID 67519085) has the molecular formula C31H34FN5O6 and a molecular weight of 591.64 g/mol. Its IUPAC name is [2-fluoro-4-[[1-(2-hydroxy-2-methylpropyl)-5-methyl-3-oxo-2-phenylpyrazole-4-carbonyl]amino]phenyl] 4,5-dimethoxy-2-(methylamino)benzenecarboximidate.
| Compound Name | [2-fluoro-4-[[1-(2-hydroxy-2-methylpropyl)-5-methyl-3-oxo-2-phenylpyrazole-4-carbonyl]amino]phenyl] 4,5-dimethoxy-2-(methylamino)benzenecarboximidate |
|---|---|
| PubChem CID | 67519085 |
| Molecular Formula | C31H34FN5O6 |
| Molecular Weight | 591.64 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | [2-fluoro-4-[[1-(2-hydroxy-2-methylpropyl)-5-methyl-3-oxo-2-phenylpyrazole-4-carbonyl]amino]phenyl] 4,5-dimethoxy-2-(methylamino)benzenecarboximidate |
| SMILES | [H]/N=C(\Oc1ccc(NC(=O)c2c(C)n(CC(C)(C)O)n(-c3ccccc3)c2=O)cc1F)c1cc(OC)c(OC)cc1NC |
| InChI | InChI=1S/C31H34FN5O6/c1-18-27(30(39)37(20-10-8-7-9-11-20)36(18)17-31(2,3)40)29(38)35-19-12-13-24(22(32)14-19)43-28(33)21-15-25(41-5)26(42-6)16-23(21)34-4/h7-16,33-34,40H,17H2,1-6H3,(H,35,38)/b33-28- |
| InChIKey | RCYNWKZKUAOGDE-MDVFONAFSA-N |
| XLogP | 4.57 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|