C23H31NO3 — CID 67519229
[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl cyclopentanecarboxylate (PubChem CID 67519229) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is [(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl cyclopentanecarboxylate.
| Compound Name | [(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 67519229 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | [(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl cyclopentanecarboxylate |
| SMILES | O=C(OCOc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)NCC3)C1CCCC1 |
| InChI | InChI=1S/C23H31NO3/c25-22(16-5-1-2-6-16)27-15-26-18-9-8-17-13-21-19-7-3-4-10-23(19,11-12-24-21)20(17)14-18/h8-9,14,16,19,21,24H,1-7,10-13,15H2/t19-,21+,23+/m0/s1 |
| InChIKey | RHJVMTZOKLNZBJ-XKCSPQBFSA-N |
| XLogP | 4.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|