About methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate
methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate (PubChem CID 67519668) has the molecular formula C22H36N2O4
and a molecular weight of 392.54 g/mol. Its IUPAC name is methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate.
Molecular Properties
| Compound Name | methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate |
| PubChem CID | 67519668 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate |
| SMILES | CCCCc1c(CCC)cc(C(=O)NC(C)(C)C(=O)OC)c(=O)n1CCCC |
| InChI | InChI=1S/C22H36N2O4/c1-7-10-13-18-16(12-9-3)15-17(20(26)24(18)14-11-8-2)19(25)23-22(4,5)21(27)28-6/h15H,7-14H2,1-6H3,(H,23,25) |
| InChIKey | WHZBCNUGZLHDPR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate?
The IUPAC name of methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate (CID 67519668) is methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate.
What is the SMILES notation for methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate?
The canonical SMILES for methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate is CCCCc1c(CCC)cc(C(=O)NC(C)(C)C(=O)OC)c(=O)n1CCCC.
What is the InChIKey of methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate?
The InChIKey is WHZBCNUGZLHDPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36N2O4/c1-7-10-13-18-16(12-9-3)15-17(20(26)24(18)14-11-8-2)19(25)23-22(4,5)21(27)28-6/h15H,7-14H2,1-6H3,(H,23,25).
What are the key properties of methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate?
methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate has a molecular weight of 392.54 g/mol, XLogP of 3.62, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1,6-dibutyl-2-oxo-5-propylpyridine-3-carbonyl)amino]-2-methylpropanoate is sourced from PubChem (CID 67519668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).