About 5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride
5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride (PubChem CID 67519693) has the molecular formula C8H8ClN3O2S
and a molecular weight of 245.69 g/mol. Its IUPAC name is 5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride |
| PubChem CID | 67519693 |
| Molecular Formula | C8H8ClN3O2S |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride |
| SMILES | Cc1nc(-c2c[nH]c(=O)[nH]c2=O)cs1.Cl |
| InChI | InChI=1S/C8H7N3O2S.ClH/c1-4-10-6(3-14-4)5-2-9-8(13)11-7(5)12;/h2-3H,1H3,(H2,9,11,12,13);1H |
| InChIKey | JVMHDIWDPFFSHZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride?
The IUPAC name of 5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride (CID 67519693) is 5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride.
What is the SMILES notation for 5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride?
The canonical SMILES for 5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride is Cc1nc(-c2c[nH]c(=O)[nH]c2=O)cs1.Cl.
What is the InChIKey of 5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride?
The InChIKey is JVMHDIWDPFFSHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2S.ClH/c1-4-10-6(3-14-4)5-2-9-8(13)11-7(5)12;/h2-3H,1H3,(H2,9,11,12,13);1H.
What are the key properties of 5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride?
5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride has a molecular weight of 245.69 g/mol, XLogP of 0.92, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyl-1,3-thiazol-4-yl)-1H-pyrimidine-2,4-dione;hydrochloride is sourced from PubChem (CID 67519693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).