C22H32N2O5 — CID 67519742
methyl 2-methyl-2-[[2-oxo-1-(oxolan-2-ylmethyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]propanoate (PubChem CID 67519742) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is methyl 2-methyl-2-[[2-oxo-1-(oxolan-2-ylmethyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]propanoate.
| Compound Name | methyl 2-methyl-2-[[2-oxo-1-(oxolan-2-ylmethyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 67519742 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | methyl 2-methyl-2-[[2-oxo-1-(oxolan-2-ylmethyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]propanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)c1cc2c(n(CC3CCCO3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C22H32N2O5/c1-22(2,21(27)28-3)23-19(25)17-13-15-9-6-4-5-7-11-18(15)24(20(17)26)14-16-10-8-12-29-16/h13,16H,4-12,14H2,1-3H3,(H,23,25) |
| InChIKey | JYHFFPGXDMDYGO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |