C25H36N2O5 — CID 67519769
methyl 4-[[2-oxo-1-(oxolan-2-ylmethyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylate (PubChem CID 67519769) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is methyl 4-[[2-oxo-1-(oxolan-2-ylmethyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[2-oxo-1-(oxolan-2-ylmethyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67519769 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | methyl 4-[[2-oxo-1-(oxolan-2-ylmethyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)c2cc3c(n(CC4CCCO4)c2=O)CCCCCC3)CC1 |
| InChI | InChI=1S/C25H36N2O5/c1-31-25(30)17-10-12-19(13-11-17)26-23(28)21-15-18-7-4-2-3-5-9-22(18)27(24(21)29)16-20-8-6-14-32-20/h15,17,19-20H,2-14,16H2,1H3,(H,26,28) |
| InChIKey | VRJGALQJWWHKOV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |