C23H31F3N2O4 — CID 67519840
3-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-4,4,4-trifluorobutanoic acid (PubChem CID 67519840) has the molecular formula C23H31F3N2O4 and a molecular weight of 456.51 g/mol. Its IUPAC name is 3-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-4,4,4-trifluorobutanoic acid.
| Compound Name | 3-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 67519840 |
| Molecular Formula | C23H31F3N2O4 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 3-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-4,4,4-trifluorobutanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1cc2c(n(CC3CCCCC3)c1=O)CCCCCC2)C(F)(F)F |
| InChI | InChI=1S/C23H31F3N2O4/c24-23(25,26)19(13-20(29)30)27-21(31)17-12-16-10-6-1-2-7-11-18(16)28(22(17)32)14-15-8-4-3-5-9-15/h12,15,19H,1-11,13-14H2,(H,27,31)(H,29,30) |
| InChIKey | PPPZJDRQYJTRFC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |