C23H34N2O5 — CID 67519877
2-[(1-butyl-4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 67519877) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is 2-[(1-butyl-4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[(1-butyl-4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67519877 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 2-[(1-butyl-4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | CCCCn1c2c(c(O)c(C(=O)NC3CCCCC3C(=O)O)c1=O)CCCCCC2 |
| InChI | InChI=1S/C23H34N2O5/c1-2-3-14-25-18-13-7-5-4-6-11-16(18)20(26)19(22(25)28)21(27)24-17-12-9-8-10-15(17)23(29)30/h15,17,26H,2-14H2,1H3,(H,24,27)(H,29,30) |
| InChIKey | RZBURBBRMUHMDP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |