C26H40N2O4 — CID 67519963
2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid (PubChem CID 67519963) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is 2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid.
| Compound Name | 2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 67519963 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)CC(NC(=O)c1cc2c(n(CC3CCCCC3)c1=O)CCCCCC2)C(=O)O |
| InChI | InChI=1S/C26H40N2O4/c1-26(2,3)16-21(25(31)32)27-23(29)20-15-19-13-9-4-5-10-14-22(19)28(24(20)30)17-18-11-7-6-8-12-18/h15,18,21H,4-14,16-17H2,1-3H3,(H,27,29)(H,31,32) |
| InChIKey | GDCMGPUFEDAFFS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |