C23H36N2O4 — CID 67519978
methyl 2-[(1-butyl-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl)amino]-3,3-dimethylbutanoate (PubChem CID 67519978) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is methyl 2-[(1-butyl-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl)amino]-3,3-dimethylbutanoate.
| Compound Name | methyl 2-[(1-butyl-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl)amino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 67519978 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | methyl 2-[(1-butyl-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl)amino]-3,3-dimethylbutanoate |
| SMILES | CCCCn1c2c(cc(C(=O)NC(C(=O)OC)C(C)(C)C)c1=O)CCCCCC2 |
| InChI | InChI=1S/C23H36N2O4/c1-6-7-14-25-18-13-11-9-8-10-12-16(18)15-17(21(25)27)20(26)24-19(22(28)29-5)23(2,3)4/h15,19H,6-14H2,1-5H3,(H,24,26) |
| InChIKey | MSYYKQUADSEIEB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |