C27H40N2O4 — CID 67520082
methyl 1-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylate (PubChem CID 67520082) has the molecular formula C27H40N2O4 and a molecular weight of 456.63 g/mol. Its IUPAC name is methyl 1-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67520082 |
| Molecular Formula | C27H40N2O4 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | methyl 1-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)c2cc3c(n(CC4CCCCC4)c2=O)CCCCCC3)CCCCC1 |
| InChI | InChI=1S/C27H40N2O4/c1-33-26(32)27(16-10-5-11-17-27)28-24(30)22-18-21-14-8-2-3-9-15-23(21)29(25(22)31)19-20-12-6-4-7-13-20/h18,20H,2-17,19H2,1H3,(H,28,30) |
| InChIKey | GIQYHXUZPMAEIB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |