C24H30N2O4 — CID 67520086
[2-[[1-(2-methylpropyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]phenyl] acetate (PubChem CID 67520086) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is [2-[[1-(2-methylpropyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]phenyl] acetate.
| Compound Name | [2-[[1-(2-methylpropyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 67520086 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | [2-[[1-(2-methylpropyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1NC(=O)c1cc2c(n(CC(C)C)c1=O)CCCCCC2 |
| InChI | InChI=1S/C24H30N2O4/c1-16(2)15-26-21-12-7-5-4-6-10-18(21)14-19(24(26)29)23(28)25-20-11-8-9-13-22(20)30-17(3)27/h8-9,11,13-14,16H,4-7,10,12,15H2,1-3H3,(H,25,28) |
| InChIKey | XBRJBFNMFDZJRI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|