C32H50N4O5 — CID 67520094
tert-butyl 4-[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]piperazine-1-carboxylate (PubChem CID 67520094) has the molecular formula C32H50N4O5 and a molecular weight of 570.78 g/mol. Its IUPAC name is tert-butyl 4-[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67520094 |
| Molecular Formula | C32H50N4O5 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.38 |
| IUPAC Name | tert-butyl 4-[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)C(C)(C)NC(=O)c2cc3c(n(CC4CCCCC4)c2=O)CCCCCC3)CC1 |
| InChI | InChI=1S/C32H50N4O5/c1-31(2,3)41-30(40)35-19-17-34(18-20-35)29(39)32(4,5)33-27(37)25-21-24-15-11-6-7-12-16-26(24)36(28(25)38)22-23-13-9-8-10-14-23/h21,23H,6-20,22H2,1-5H3,(H,33,37) |
| InChIKey | KRMABUHYZNREDD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |