C48H56N2O4 — CID 67520238
2-amino-5-[4-[3-[3-[4-(4-amino-3-hydroxyphenoxy)phenyl]-5,7-dimethyl-1-adamantyl]-5,7-dimethyl-1-adamantyl]phenoxy]phenol (PubChem CID 67520238) has the molecular formula C48H56N2O4 and a molecular weight of 724.99 g/mol. Its IUPAC name is 2-amino-5-[4-[3-[3-[4-(4-amino-3-hydroxyphenoxy)phenyl]-5,7-dimethyl-1-adamantyl]-5,7-dimethyl-1-adamantyl]phenoxy]phenol.
| Compound Name | 2-amino-5-[4-[3-[3-[4-(4-amino-3-hydroxyphenoxy)phenyl]-5,7-dimethyl-1-adamantyl]-5,7-dimethyl-1-adamantyl]phenoxy]phenol |
|---|---|
| PubChem CID | 67520238 |
| Molecular Formula | C48H56N2O4 |
| Molecular Weight | 724.99 g/mol |
| Exact Mass | 724.42 |
| IUPAC Name | 2-amino-5-[4-[3-[3-[4-(4-amino-3-hydroxyphenoxy)phenyl]-5,7-dimethyl-1-adamantyl]-5,7-dimethyl-1-adamantyl]phenoxy]phenol |
| SMILES | CC12CC3(C)CC(c4ccc(Oc5ccc(N)c(O)c5)cc4)(C1)CC(C14CC5(C)CC(C)(CC(c6ccc(Oc7ccc(N)c(O)c7)cc6)(C5)C1)C4)(C2)C3 |
| InChI | InChI=1S/C48H56N2O4/c1-41-19-42(2)22-45(21-41,31-5-9-33(10-6-31)53-35-13-15-37(49)39(51)17-35)29-47(25-41,26-42)48-27-43(3)20-44(4,28-48)24-46(23-43,30-48)32-7-11-34(12-8-32)54-36-14-16-38(50)40(52)18-36/h5-18,51-52H,19-30,49-50H2,1-4H3 |
| InChIKey | FGZAZSKMOJARLT-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.99 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|