About methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate
methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate (PubChem CID 67520241) has the molecular formula C17H26N2O4
and a molecular weight of 322.41 g/mol. Its IUPAC name is methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate.
Molecular Properties
| Compound Name | methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate |
| PubChem CID | 67520241 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate |
| SMILES | CCCCn1c(C)c(C)cc(C(=O)NC(C)(C)C(=O)OC)c1=O |
| InChI | InChI=1S/C17H26N2O4/c1-7-8-9-19-12(3)11(2)10-13(15(19)21)14(20)18-17(4,5)16(22)23-6/h10H,7-9H2,1-6H3,(H,18,20) |
| InChIKey | JSNVXUOFIOGKGO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate?
The IUPAC name of methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate (CID 67520241) is methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate.
What is the SMILES notation for methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate?
The canonical SMILES for methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate is CCCCn1c(C)c(C)cc(C(=O)NC(C)(C)C(=O)OC)c1=O.
What is the InChIKey of methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate?
The InChIKey is JSNVXUOFIOGKGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O4/c1-7-8-9-19-12(3)11(2)10-13(15(19)21)14(20)18-17(4,5)16(22)23-6/h10H,7-9H2,1-6H3,(H,18,20).
What are the key properties of methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate?
methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate has a molecular weight of 322.41 g/mol, XLogP of 1.95, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-2-methylpropanoate is sourced from PubChem (CID 67520241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).