C25H37N3O5 — CID 67520284
2-[[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]amino]acetic acid (PubChem CID 67520284) has the molecular formula C25H37N3O5 and a molecular weight of 459.59 g/mol. Its IUPAC name is 2-[[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 67520284 |
| Molecular Formula | C25H37N3O5 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | 2-[[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]amino]acetic acid |
| SMILES | CC(C)(NC(=O)c1cc2c(n(CC3CCCCC3)c1=O)CCCCCC2)C(=O)NCC(=O)O |
| InChI | InChI=1S/C25H37N3O5/c1-25(2,24(33)26-15-21(29)30)27-22(31)19-14-18-12-8-3-4-9-13-20(18)28(23(19)32)16-17-10-6-5-7-11-17/h14,17H,3-13,15-16H2,1-2H3,(H,26,33)(H,27,31)(H,29,30) |
| InChIKey | AZIWIICQCIRNGS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |