About methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate
methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate (PubChem CID 67520456) has the molecular formula C20H30N2O4
and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate |
| PubChem CID | 67520456 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate |
| SMILES | CCCCn1c(C)c(C)cc(C(=O)NC2(C(=O)OC)CCCCC2)c1=O |
| InChI | InChI=1S/C20H30N2O4/c1-5-6-12-22-15(3)14(2)13-16(18(22)24)17(23)21-20(19(25)26-4)10-8-7-9-11-20/h13H,5-12H2,1-4H3,(H,21,23) |
| InChIKey | PYFHJXGZGPXWCD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate?
The IUPAC name of methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate (CID 67520456) is methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate is CCCCn1c(C)c(C)cc(C(=O)NC2(C(=O)OC)CCCCC2)c1=O.
What is the InChIKey of methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate?
The InChIKey is PYFHJXGZGPXWCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N2O4/c1-5-6-12-22-15(3)14(2)13-16(18(22)24)17(23)21-20(19(25)26-4)10-8-7-9-11-20/h13H,5-12H2,1-4H3,(H,21,23).
What are the key properties of methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate?
methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate has a molecular weight of 362.47 g/mol, XLogP of 2.87, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(1-butyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate is sourced from PubChem (CID 67520456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).