C20H20BClFN3O2 — CID 67520645
3-(5-chloro-8-fluoroisoquinolin-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 67520645) has the molecular formula C20H20BClFN3O2 and a molecular weight of 399.66 g/mol. Its IUPAC name is 3-(5-chloro-8-fluoroisoquinolin-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 3-(5-chloro-8-fluoroisoquinolin-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 67520645 |
| Molecular Formula | C20H20BClFN3O2 |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-(5-chloro-8-fluoroisoquinolin-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | CC1(C)OB(c2cnc(N)c(-c3cc4c(Cl)ccc(F)c4cn3)c2)OC1(C)C |
| InChI | InChI=1S/C20H20BClFN3O2/c1-19(2)20(3,4)28-21(27-19)11-7-13(18(24)26-9-11)17-8-12-14(10-25-17)16(23)6-5-15(12)22/h5-10H,1-4H3,(H2,24,26) |
| InChIKey | UHBKAXZYUIYRTG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|