About 5-chloro-6,8-difluoro-2H-isoquinolin-3-one
5-chloro-6,8-difluoro-2H-isoquinolin-3-one (PubChem CID 67520742) has the molecular formula C9H4ClF2NO
and a molecular weight of 215.59 g/mol. Its IUPAC name is 5-chloro-6,8-difluoro-2H-isoquinolin-3-one.
Molecular Properties
| Compound Name | 5-chloro-6,8-difluoro-2H-isoquinolin-3-one |
| PubChem CID | 67520742 |
| Molecular Formula | C9H4ClF2NO |
| Molecular Weight | 215.59 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 5-chloro-6,8-difluoro-2H-isoquinolin-3-one |
| SMILES | O=c1cc2c(Cl)c(F)cc(F)c2c[nH]1 |
| InChI | InChI=1S/C9H4ClF2NO/c10-9-4-1-8(14)13-3-5(4)6(11)2-7(9)12/h1-3H,(H,13,14) |
| InChIKey | VNNSSKNSKUPRRE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.59 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-6,8-difluoro-2H-isoquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6,8-difluoro-2H-isoquinolin-3-one?
The IUPAC name of 5-chloro-6,8-difluoro-2H-isoquinolin-3-one (CID 67520742) is 5-chloro-6,8-difluoro-2H-isoquinolin-3-one.
What is the SMILES notation for 5-chloro-6,8-difluoro-2H-isoquinolin-3-one?
The canonical SMILES for 5-chloro-6,8-difluoro-2H-isoquinolin-3-one is O=c1cc2c(Cl)c(F)cc(F)c2c[nH]1.
What is the InChIKey of 5-chloro-6,8-difluoro-2H-isoquinolin-3-one?
The InChIKey is VNNSSKNSKUPRRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4ClF2NO/c10-9-4-1-8(14)13-3-5(4)6(11)2-7(9)12/h1-3H,(H,13,14).
What are the key properties of 5-chloro-6,8-difluoro-2H-isoquinolin-3-one?
5-chloro-6,8-difluoro-2H-isoquinolin-3-one has a molecular weight of 215.59 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6,8-difluoro-2H-isoquinolin-3-one is sourced from PubChem (CID 67520742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).