C28H28ClIN6O2 — CID 67521456
1-[2-[5-(3-chloro-4-methoxyphenyl)-3-pyridin-4-yl-1,2,4-triazol-1-yl]ethyl]-1-cyclopentyl-3-(4-iodophenyl)urea (PubChem CID 67521456) has the molecular formula C28H28ClIN6O2 and a molecular weight of 642.93 g/mol. Its IUPAC name is 1-[2-[5-(3-chloro-4-methoxyphenyl)-3-pyridin-4-yl-1,2,4-triazol-1-yl]ethyl]-1-cyclopentyl-3-(4-iodophenyl)urea.
| Compound Name | 1-[2-[5-(3-chloro-4-methoxyphenyl)-3-pyridin-4-yl-1,2,4-triazol-1-yl]ethyl]-1-cyclopentyl-3-(4-iodophenyl)urea |
|---|---|
| PubChem CID | 67521456 |
| Molecular Formula | C28H28ClIN6O2 |
| Molecular Weight | 642.93 g/mol |
| Exact Mass | 642.10 |
| IUPAC Name | 1-[2-[5-(3-chloro-4-methoxyphenyl)-3-pyridin-4-yl-1,2,4-triazol-1-yl]ethyl]-1-cyclopentyl-3-(4-iodophenyl)urea |
| SMILES | COc1ccc(-c2nc(-c3ccncc3)nn2CCN(C(=O)Nc2ccc(I)cc2)C2CCCC2)cc1Cl |
| InChI | InChI=1S/C28H28ClIN6O2/c1-38-25-11-6-20(18-24(25)29)27-33-26(19-12-14-31-15-13-19)34-36(27)17-16-35(23-4-2-3-5-23)28(37)32-22-9-7-21(30)8-10-22/h6-15,18,23H,2-5,16-17H2,1H3,(H,32,37) |
| InChIKey | PDLVFGWOGZXILD-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.93 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|