C13H29N2O4P — CID 67521741
dipropan-2-yl phosphate;1,2,3,4-tetramethyl-4,5-dihydroimidazol-1-ium (PubChem CID 67521741) has the molecular formula C13H29N2O4P and a molecular weight of 308.36 g/mol. Its IUPAC name is dipropan-2-yl phosphate;1,2,3,4-tetramethyl-4,5-dihydroimidazol-1-ium.
| Compound Name | dipropan-2-yl phosphate;1,2,3,4-tetramethyl-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 67521741 |
| Molecular Formula | C13H29N2O4P |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | dipropan-2-yl phosphate;1,2,3,4-tetramethyl-4,5-dihydroimidazol-1-ium |
| SMILES | CC(C)OP(=O)([O-])OC(C)C.CC1=[N+](C)CC(C)N1C |
| InChI | InChI=1S/C7H15N2.C6H15O4P/c1-6-5-8(3)7(2)9(6)4;1-5(2)9-11(7,8)10-6(3)4/h6H,5H2,1-4H3;5-6H,1-4H3,(H,7,8)/q+1;/p-1 |
| InChIKey | ADYQBBIFKUVFDX-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|