C22H20F2N2O2S — CID 67521767
N-[(4-fluoro-2-hydroxyphenyl)methyl]-2-[3-(4-fluorophenyl)propylsulfanyl]pyridine-3-carboxamide (PubChem CID 67521767) has the molecular formula C22H20F2N2O2S and a molecular weight of 414.48 g/mol. Its IUPAC name is N-[(4-fluoro-2-hydroxyphenyl)methyl]-2-[3-(4-fluorophenyl)propylsulfanyl]pyridine-3-carboxamide.
| Compound Name | N-[(4-fluoro-2-hydroxyphenyl)methyl]-2-[3-(4-fluorophenyl)propylsulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67521767 |
| Molecular Formula | C22H20F2N2O2S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[(4-fluoro-2-hydroxyphenyl)methyl]-2-[3-(4-fluorophenyl)propylsulfanyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1O)c1cccnc1SCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H20F2N2O2S/c23-17-8-5-15(6-9-17)3-2-12-29-22-19(4-1-11-25-22)21(28)26-14-16-7-10-18(24)13-20(16)27/h1,4-11,13,27H,2-3,12,14H2,(H,26,28) |
| InChIKey | DNIAXCOUQWVDLP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|