About 4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium
4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium (PubChem CID 67521856) has the molecular formula C7H15N2O+
and a molecular weight of 143.21 g/mol. Its IUPAC name is 4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium.
Molecular Properties
| Compound Name | 4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium |
| PubChem CID | 67521856 |
| Molecular Formula | C7H15N2O+ |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.12 |
| IUPAC Name | 4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium |
| SMILES | COC1C[N+](C)=C(C)N1C |
| InChI | InChI=1S/C7H15N2O/c1-6-8(2)5-7(10-4)9(6)3/h7H,5H2,1-4H3/q+1 |
| InChIKey | LCRWHSGLYWODJG-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium?
The IUPAC name of 4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium (CID 67521856) is 4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium.
What is the SMILES notation for 4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium?
The canonical SMILES for 4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium is COC1C[N+](C)=C(C)N1C.
What is the InChIKey of 4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium?
The InChIKey is LCRWHSGLYWODJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N2O/c1-6-8(2)5-7(10-4)9(6)3/h7H,5H2,1-4H3/q+1.
What are the key properties of 4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium?
4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium has a molecular weight of 143.21 g/mol, XLogP of -0.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1,2,3-trimethyl-4,5-dihydroimidazol-1-ium is sourced from PubChem (CID 67521856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).